Boc-6-AMinopyridine-3-boronic acid - Names and Identifiers
Name | 6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid
|
Synonyms | Boc-6-AMinopyridine-3-boronic acid 2-BOC-AMINO PYRIDINE-5-BORONIC ACID 6-(N-Boc-amino)pyridine-3-boronic acid 6-(N-Boc-aMino)pyridine-3-boronic acid 6-(t-butoxycarbonylamino)-pyridine-3-boronic acid 6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid [6-[(tert-Butoxycarbonyl)amino]pyridin-3-yl]boronic acid (5-Borono-2-pyridinyl)-carbamic acid C-(1,1-dimethylethyl) ester CarbaMic acid, N-(5-borono-2-pyridinyl)-, 1,1-diMethylethyl ester [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid
|
CAS | 883231-20-7
|
InChI | InChI=1S/C10H15BN2O4/c1-10(2,3)17-9(14)13-8-5-4-7(6-12-8)11(15)16/h4-6,15-16H,1-3H3,(H,12,13,14) |
Boc-6-AMinopyridine-3-boronic acid - Physico-chemical Properties
Molecular Formula | C10H15BN2O4
|
Molar Mass | 238.05 |
Density | 1.23 |
pKa | 6.94±0.18(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Boc-6-AMinopyridine-3-boronic acid - Introduction
6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid is a chemical substance that contains a Boc protecting group, an amino group, and a boronic acid functional group in its structure.
Nature:
-Appearance: White to light yellow solid
-Molecular formula: C12H17BN2O4
-Molecular weight: 274.09g/mol
-Melting point: about 160-165°C
-Solubility: Soluble in common organic solvents such as chloroform, dimethyl sulfoxide and dichloromethane
Use:
6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid is a commonly used organic synthesis intermediate, which can be used to synthesize various organic compounds. It is widely used in the fields of drug synthesis, pesticide synthesis and material chemistry.
Preparation Method:
The preparation of 6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid is usually carried out by the following steps:
1. Reaction of 3-bromopyridine with tert-butyl carbamate to give 2-(N-Boc-amino) pyridine.
2. react 2-(N-Boc-amino) pyridine with boric acid to generate the target product 6-(tert-butoxycarbonylamino)pyridin-3-ylboronic acid.
Safety Information:
Because there is not much specific toxicity data for this compound, appropriate laboratory safety measures should be taken when using it, such as wearing appropriate protective equipment (e. g. gloves, eye protection and protective clothing). At the same time, the correct use and disposal methods of laboratories and chemicals should be observed to ensure personal safety and environmental protection.
Last Update:2024-04-09 21:11:58